phenol, 5-(aminomethyl)-2-methoxy-
Catalog No: FT-0695225
CAS No: 42365-68-4
- Chemical Name: phenol, 5-(aminomethyl)-2-methoxy-
- Molecular Formula: C8H12ClNO2
- Molecular Weight: 189.64
- InChI Key: IEVBKUSXLSVMOB-UHFFFAOYSA-N
- InChI: InChI=1S/C8H11NO2.ClH/c1-11-8-3-2-6(5-9)4-7(8)10;/h2-4,10H,5,9H2,1H3;1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 189.63900 |
| Density: | 1.161g/cm3 |
| CAS: | 42365-68-4 |
| Bolling_Point: | 295.3ºC at 760 mmHg |
| Product_Name: | 5-(aminomethyl)-2-methoxyphenol,hydrochloride |
| Melting_Point: | 190-195ºC(lit.) |
| Flash_Point: | 132.4ºC |
| MF: | C8H12ClNO2 |
| Density: | 1.161g/cm3 |
|---|---|
| LogP: | 2.36180 |
| Flash_Point: | 132.4ºC |
| Melting_Point: | 190-195ºC(lit.) |
| FW: | 189.63900 |
| PSA: | 55.48000 |
| Exact_Mass: | 189.05600 |
| MF: | C8H12ClNO2 |
| Bolling_Point: | 295.3ºC at 760 mmHg |
| Refractive_Index: | 1.57 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Hazard_Codes: | Xi |
| Risk_Statements(EU): | 36-43 |
| Safety_Statements: | 26-37/39 |
| Symbol: | Warning |
| Warning_Statement: | P280-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2922509090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)